C29H33FN6OS — CID 88609606
1-[4-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]phenyl]-3-methylsulfanylurea (PubChem CID 88609606) has the molecular formula C29H33FN6OS and a molecular weight of 532.69 g/mol. Its IUPAC name is 1-[4-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]phenyl]-3-methylsulfanylurea.
| Compound Name | 1-[4-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]phenyl]-3-methylsulfanylurea |
|---|---|
| PubChem CID | 88609606 |
| Molecular Formula | C29H33FN6OS |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 1-[4-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]phenyl]-3-methylsulfanylurea |
| SMILES | CSNC(=O)Nc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H33FN6OS/c1-38-34-29(37)32-24-12-8-21(9-13-24)14-17-35-18-15-25(16-19-35)31-28-33-26-4-2-3-5-27(26)36(28)20-22-6-10-23(30)11-7-22/h2-13,25H,14-20H2,1H3,(H,31,33)(H2,32,34,37) |
| InChIKey | MSACGWPLPAJTPH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|