C35H36Cl2FN7OS — CID 88622211
1-[2-[(3,4-dichlorophenyl)methylamino]phenyl]-3-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethylsulfanyl]urea (PubChem CID 88622211) has the molecular formula C35H36Cl2FN7OS and a molecular weight of 692.69 g/mol. Its IUPAC name is 1-[2-[(3,4-dichlorophenyl)methylamino]phenyl]-3-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethylsulfanyl]urea.
| Compound Name | 1-[2-[(3,4-dichlorophenyl)methylamino]phenyl]-3-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethylsulfanyl]urea |
|---|---|
| PubChem CID | 88622211 |
| Molecular Formula | C35H36Cl2FN7OS |
| Molecular Weight | 692.69 g/mol |
| Exact Mass | 691.21 |
| IUPAC Name | 1-[2-[(3,4-dichlorophenyl)methylamino]phenyl]-3-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethylsulfanyl]urea |
| SMILES | O=C(NSCCN1CCC(Nc2nc3ccccc3n2Cc2ccc(F)cc2)CC1)Nc1ccccc1NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C35H36Cl2FN7OS/c36-28-14-11-25(21-29(28)37)22-39-30-5-1-2-6-31(30)42-35(46)43-47-20-19-44-17-15-27(16-18-44)40-34-41-32-7-3-4-8-33(32)45(34)23-24-9-12-26(38)13-10-24/h1-14,21,27,39H,15-20,22-23H2,(H,40,41)(H2,42,43,46) |
| InChIKey | YFXXVTBMIBGYHK-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.69 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|