C19H26O5S — CID 14019331
methyl (3E)-7-hydroxy-4,8-dimethyl-2-(4-methylphenyl)sulfonylnona-3,8-dienoate (PubChem CID 14019331) has the molecular formula C19H26O5S and a molecular weight of 366.48 g/mol. Its IUPAC name is methyl (3E)-7-hydroxy-4,8-dimethyl-2-(4-methylphenyl)sulfonylnona-3,8-dienoate.
| Compound Name | methyl (3E)-7-hydroxy-4,8-dimethyl-2-(4-methylphenyl)sulfonylnona-3,8-dienoate |
|---|---|
| PubChem CID | 14019331 |
| Molecular Formula | C19H26O5S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | methyl (3E)-7-hydroxy-4,8-dimethyl-2-(4-methylphenyl)sulfonylnona-3,8-dienoate |
| SMILES | C=C(C)C(O)CC/C(C)=C/C(C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H26O5S/c1-13(2)17(20)11-8-15(4)12-18(19(21)24-5)25(22,23)16-9-6-14(3)7-10-16/h6-7,9-10,12,17-18,20H,1,8,11H2,2-5H3/b15-12+ |
| InChIKey | PHISQPPHLHWEJU-NTCAYCPXSA-N |
| XLogP | 2.97 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|