C8H11NO3 — CID 14021827
1-hydroxy-7-(hydroxymethyl)-1,2,5,8-tetrahydropyrrolizin-3-one (PubChem CID 14021827) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-hydroxy-7-(hydroxymethyl)-1,2,5,8-tetrahydropyrrolizin-3-one.
| Compound Name | 1-hydroxy-7-(hydroxymethyl)-1,2,5,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 14021827 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-hydroxy-7-(hydroxymethyl)-1,2,5,8-tetrahydropyrrolizin-3-one |
| SMILES | O=C1CC(O)C2C(CO)=CCN12 |
| InChI | InChI=1S/C8H11NO3/c10-4-5-1-2-9-7(12)3-6(11)8(5)9/h1,6,8,10-11H,2-4H2 |
| InChIKey | IMRIYXREMCLVTM-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|