C11H10F3NO — CID 14022934
2,2,2-trifluoro-1-(3-methyl-1H-indol-2-yl)ethanol (PubChem CID 14022934) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-methyl-1H-indol-2-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(3-methyl-1H-indol-2-yl)ethanol |
|---|---|
| PubChem CID | 14022934 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-methyl-1H-indol-2-yl)ethanol |
| SMILES | Cc1c(C(O)C(F)(F)F)[nH]c2ccccc12 |
| InChI | InChI=1S/C11H10F3NO/c1-6-7-4-2-3-5-8(7)15-9(6)10(16)11(12,13)14/h2-5,10,15-16H,1H3 |
| InChIKey | WDQJQQMFBIYHTH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |