C12H24O2 — CID 14028841
8,8-dimethoxy-2,6-dimethyloct-1-ene (PubChem CID 14028841) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 8,8-dimethoxy-2,6-dimethyloct-1-ene.
| Compound Name | 8,8-dimethoxy-2,6-dimethyloct-1-ene |
|---|---|
| PubChem CID | 14028841 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 8,8-dimethoxy-2,6-dimethyloct-1-ene |
| SMILES | C=C(C)CCCC(C)CC(OC)OC |
| InChI | InChI=1S/C12H24O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h11-12H,1,6-9H2,2-5H3 |
| InChIKey | AZXRBAVDFHBHLA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|