About 1,3-dibromo-2,4-dichlorobenzene
1,3-dibromo-2,4-dichlorobenzene (PubChem CID 14029666) has the molecular formula C6H2Br2Cl2
and a molecular weight of 304.80 g/mol. Its IUPAC name is 1,3-dibromo-2,4-dichlorobenzene.
Molecular Properties
| Compound Name | 1,3-dibromo-2,4-dichlorobenzene |
| PubChem CID | 14029666 |
| Molecular Formula | C6H2Br2Cl2 |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 301.79 |
| IUPAC Name | 1,3-dibromo-2,4-dichlorobenzene |
| SMILES | Clc1ccc(Br)c(Cl)c1Br |
| InChI | InChI=1S/C6H2Br2Cl2/c7-3-1-2-4(9)5(8)6(3)10/h1-2H |
| InChIKey | XEUDFUBIELPUTO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromo-2,4-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-2,4-dichlorobenzene?
The IUPAC name of 1,3-dibromo-2,4-dichlorobenzene (CID 14029666) is 1,3-dibromo-2,4-dichlorobenzene.
What is the SMILES notation for 1,3-dibromo-2,4-dichlorobenzene?
The canonical SMILES for 1,3-dibromo-2,4-dichlorobenzene is Clc1ccc(Br)c(Cl)c1Br.
What is the InChIKey of 1,3-dibromo-2,4-dichlorobenzene?
The InChIKey is XEUDFUBIELPUTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br2Cl2/c7-3-1-2-4(9)5(8)6(3)10/h1-2H.
What are the key properties of 1,3-dibromo-2,4-dichlorobenzene?
1,3-dibromo-2,4-dichlorobenzene has a molecular weight of 304.80 g/mol, XLogP of 4.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-2,4-dichlorobenzene is sourced from PubChem (CID 14029666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).