C16H22F2O5S — CID 140308988
Methyl 2,2-difluoro-8-(4-methylphenyl)sulfonyloxyoctanoate (PubChem CID 140308988) has the molecular formula C16H22F2O5S and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 2,2-difluoro-8-(4-methylphenyl)sulfonyloxyoctanoate.
| Compound Name | Methyl 2,2-difluoro-8-(4-methylphenyl)sulfonyloxyoctanoate |
|---|---|
| PubChem CID | 140308988 |
| Molecular Formula | C16H22F2O5S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | methyl 2,2-difluoro-8-(4-methylphenyl)sulfonyloxyoctanoate |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCCCC(C(=O)OC)(F)F |
| InChI | InChI=1S/C16H22F2O5S/c1-13-7-9-14(10-8-13)24(20,21)23-12-6-4-3-5-11-16(17,18)15(19)22-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | OHUSOZAKVYYHJR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | 479 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|