C9H6Cl3F6N2P — CID 14033018
3-methyl-5-(1,2,2-trichloroethenyl)benzenediazonium hexafluorophosphate (PubChem CID 14033018) has the molecular formula C9H6Cl3F6N2P and a molecular weight of 393.48 g/mol. Its IUPAC name is 3-methyl-5-(1,2,2-trichloroethenyl)benzenediazonium hexafluorophosphate.
| Compound Name | 3-methyl-5-(1,2,2-trichloroethenyl)benzenediazonium hexafluorophosphate |
|---|---|
| PubChem CID | 14033018 |
| Molecular Formula | C9H6Cl3F6N2P |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | 3-methyl-5-(1,2,2-trichloroethenyl)benzenediazonium hexafluorophosphate |
| SMILES | Cc1cc([N+]#N)cc(C(Cl)=C(Cl)Cl)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C9H6Cl3N2.F6P/c1-5-2-6(8(10)9(11)12)4-7(3-5)14-13;1-7(2,3,4,5)6/h2-4H,1H3;/q+1;-1 |
| InChIKey | LOWNGQBFOZBRTB-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|