C26H31F3N2O2 — CID 1403394
(3R,3aR,8aR,9aR)-5,8a-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one (PubChem CID 1403394) has the molecular formula C26H31F3N2O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is (3R,3aR,8aR,9aR)-5,8a-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3R,3aR,8aR,9aR)-5,8a-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 1403394 |
| Molecular Formula | C26H31F3N2O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (3R,3aR,8aR,9aR)-5,8a-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=CCC[C@]2(C)C[C@H]3OC(=O)[C@@H](CN4CCN(c5cccc(C(F)(F)F)c5)CC4)[C@H]3C=C12 |
| InChI | InChI=1S/C26H31F3N2O2/c1-17-5-4-8-25(2)15-23-20(14-22(17)25)21(24(32)33-23)16-30-9-11-31(12-10-30)19-7-3-6-18(13-19)26(27,28)29/h3,5-7,13-14,20-21,23H,4,8-12,15-16H2,1-2H3/t20-,21+,23-,25-/m1/s1 |
| InChIKey | OTJIEBRBPKGBEQ-SWXWDQRWSA-N |
| XLogP | 5.06 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |