C21H32N2O2 — CID 118947124
3,3-diethyl-5-[3-(4-phenylpiperazin-1-yl)propyl]oxolan-2-one (PubChem CID 118947124) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3,3-diethyl-5-[3-(4-phenylpiperazin-1-yl)propyl]oxolan-2-one.
| Compound Name | 3,3-diethyl-5-[3-(4-phenylpiperazin-1-yl)propyl]oxolan-2-one |
|---|---|
| PubChem CID | 118947124 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 3,3-diethyl-5-[3-(4-phenylpiperazin-1-yl)propyl]oxolan-2-one |
| SMILES | CCC1(CC)CC(CCCN2CCN(c3ccccc3)CC2)OC1=O |
| InChI | InChI=1S/C21H32N2O2/c1-3-21(4-2)17-19(25-20(21)24)11-8-12-22-13-15-23(16-14-22)18-9-6-5-7-10-18/h5-7,9-10,19H,3-4,8,11-17H2,1-2H3 |
| InChIKey | URQMJLAVNBICBT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |