C20H30N2O2 — CID 86274341
3,3-diethyl-5-[2-(4-phenylpiperazin-1-yl)ethyl]oxolan-2-one (PubChem CID 86274341) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3,3-diethyl-5-[2-(4-phenylpiperazin-1-yl)ethyl]oxolan-2-one.
| Compound Name | 3,3-diethyl-5-[2-(4-phenylpiperazin-1-yl)ethyl]oxolan-2-one |
|---|---|
| PubChem CID | 86274341 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 3,3-diethyl-5-[2-(4-phenylpiperazin-1-yl)ethyl]oxolan-2-one |
| SMILES | CCC1(CC)CC(CCN2CCN(c3ccccc3)CC2)OC1=O |
| InChI | InChI=1S/C20H30N2O2/c1-3-20(4-2)16-18(24-19(20)23)10-11-21-12-14-22(15-13-21)17-8-6-5-7-9-17/h5-9,18H,3-4,10-16H2,1-2H3 |
| InChIKey | QPEAHEGNDXBFIU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |