C12H18O3 — CID 14033942
(2S)-2-[(1S,6R)-6-formyl-2,6-dimethylcyclohex-2-en-1-yl]propanoic acid (PubChem CID 14033942) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2S)-2-[(1S,6R)-6-formyl-2,6-dimethylcyclohex-2-en-1-yl]propanoic acid.
| Compound Name | (2S)-2-[(1S,6R)-6-formyl-2,6-dimethylcyclohex-2-en-1-yl]propanoic acid |
|---|---|
| PubChem CID | 14033942 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2S)-2-[(1S,6R)-6-formyl-2,6-dimethylcyclohex-2-en-1-yl]propanoic acid |
| SMILES | CC1=CCC[C@@](C)(C=O)[C@H]1[C@H](C)C(=O)O |
| InChI | InChI=1S/C12H18O3/c1-8-5-4-6-12(3,7-13)10(8)9(2)11(14)15/h5,7,9-10H,4,6H2,1-3H3,(H,14,15)/t9-,10+,12-/m0/s1 |
| InChIKey | IXJJXTCIONXVJL-UMNHJUIQSA-N |
| XLogP | 2.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|