C13H20O2 — CID 15433129
2-[(1S,5R)-1,2-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]acetic acid (PubChem CID 15433129) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-[(1S,5R)-1,2-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,5R)-1,2-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 15433129 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-[(1S,5R)-1,2-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]acetic acid |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@](C)(CC(=O)O)C1 |
| InChI | InChI=1S/C13H20O2/c1-9(2)11-6-5-10(3)13(4,7-11)8-12(14)15/h5,11H,1,6-8H2,2-4H3,(H,14,15)/t11-,13+/m1/s1 |
| InChIKey | JRLZJEPCAFERLD-YPMHNXCESA-N |
| XLogP | 3.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|