C10H14F2 — CID 11052100
(4R)-6,6-difluoro-1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 11052100) has the molecular formula C10H14F2 and a molecular weight of 172.22 g/mol. Its IUPAC name is (4R)-6,6-difluoro-1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | (4R)-6,6-difluoro-1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 11052100 |
| Molecular Formula | C10H14F2 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (4R)-6,6-difluoro-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)[C@@H]1CC=C(C)C(F)(F)C1 |
| InChI | InChI=1S/C10H14F2/c1-7(2)9-5-4-8(3)10(11,12)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m1/s1 |
| InChIKey | HJCBBPROBXFYGS-SECBINFHSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|