C15H23F — CID 102286380
(4S,4aS,6S)-4a-(fluoromethyl)-4-methyl-6-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene (PubChem CID 102286380) has the molecular formula C15H23F and a molecular weight of 222.35 g/mol. Its IUPAC name is (4S,4aS,6S)-4a-(fluoromethyl)-4-methyl-6-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene.
| Compound Name | (4S,4aS,6S)-4a-(fluoromethyl)-4-methyl-6-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 102286380 |
| Molecular Formula | C15H23F |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (4S,4aS,6S)-4a-(fluoromethyl)-4-methyl-6-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
| SMILES | C=C(C)[C@H]1CC=C2CCC[C@H](C)[C@@]2(CF)C1 |
| InChI | InChI=1S/C15H23F/c1-11(2)13-7-8-14-6-4-5-12(3)15(14,9-13)10-16/h8,12-13H,1,4-7,9-10H2,2-3H3/t12-,13-,15-/m0/s1 |
| InChIKey | FOELBWFRHHRGSW-YDHLFZDLSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|