C21H28O2 — CID 68965556
(3E,4aS,5S)-5-hydroxy-4a-methyl-3-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68965556) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (3E,4aS,5S)-5-hydroxy-4a-methyl-3-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4aS,5S)-5-hydroxy-4a-methyl-3-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68965556 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (3E,4aS,5S)-5-hydroxy-4a-methyl-3-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | C=C(C)[C@@H]1CC=C(/C=C2\C[C@@]3(C)C(=CC2=O)CCC[C@@H]3O)CC1 |
| InChI | InChI=1S/C21H28O2/c1-14(2)16-9-7-15(8-10-16)11-17-13-21(3)18(12-19(17)22)5-4-6-20(21)23/h7,11-12,16,20,23H,1,4-6,8-10,13H2,2-3H3/b17-11+/t16-,20+,21+/m1/s1 |
| InChIKey | KSDJQYBJYIVEDX-ZTFCMYMRSA-N |
| XLogP | 4.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|