C26H33F3N2O3 — CID 1403558
(3R,3aS,4S,4aR,5R,9aR)-4-hydroxy-4a,5-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 1403558) has the molecular formula C26H33F3N2O3 and a molecular weight of 478.56 g/mol. Its IUPAC name is (3R,3aS,4S,4aR,5R,9aR)-4-hydroxy-4a,5-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3R,3aS,4S,4aR,5R,9aR)-4-hydroxy-4a,5-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 1403558 |
| Molecular Formula | C26H33F3N2O3 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (3R,3aS,4S,4aR,5R,9aR)-4-hydroxy-4a,5-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@@H]1CCC=C2C[C@H]3OC(=O)[C@@H](CN4CCN(c5cccc(C(F)(F)F)c5)CC4)[C@H]3[C@H](O)[C@@]21C |
| InChI | InChI=1S/C26H33F3N2O3/c1-16-5-3-6-17-14-21-22(23(32)25(16,17)2)20(24(33)34-21)15-30-9-11-31(12-10-30)19-8-4-7-18(13-19)26(27,28)29/h4,6-8,13,16,20-23,32H,3,5,9-12,14-15H2,1-2H3/t16-,20+,21-,22-,23+,25-/m1/s1 |
| InChIKey | ACXRFOZINXTJCC-AVWDQLLDSA-N |
| XLogP | 4.11 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|