C27H37F3N2O4 — CID 3632375
4a-hydroxy-5-methoxy-5,8a-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 3632375) has the molecular formula C27H37F3N2O4 and a molecular weight of 510.60 g/mol. Its IUPAC name is 4a-hydroxy-5-methoxy-5,8a-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 4a-hydroxy-5-methoxy-5,8a-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 3632375 |
| Molecular Formula | C27H37F3N2O4 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 4a-hydroxy-5-methoxy-5,8a-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | COC1(C)CCCC2(C)CC3OC(=O)C(CN4CCN(c5cccc(C(F)(F)F)c5)CC4)C3CC21O |
| InChI | InChI=1S/C27H37F3N2O4/c1-24-8-5-9-25(2,35-3)26(24,34)15-20-21(23(33)36-22(20)16-24)17-31-10-12-32(13-11-31)19-7-4-6-18(14-19)27(28,29)30/h4,6-7,14,20-22,34H,5,8-13,15-17H2,1-3H3 |
| InChIKey | VTZRNFGNLKRMNG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |