C26H34F3N2O3+ — CID 1403559
(3R,3aS,4R,4aR,5S,9aR)-4-hydroxy-4a,5-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 1403559) has the molecular formula C26H34F3N2O3+ and a molecular weight of 479.56 g/mol. Its IUPAC name is (3R,3aS,4R,4aR,5S,9aR)-4-hydroxy-4a,5-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3R,3aS,4R,4aR,5S,9aR)-4-hydroxy-4a,5-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 1403559 |
| Molecular Formula | C26H34F3N2O3+ |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (3R,3aS,4R,4aR,5S,9aR)-4-hydroxy-4a,5-dimethyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@H]1CCC=C2C[C@H]3OC(=O)[C@@H](C[NH+]4CCN(c5cccc(C(F)(F)F)c5)CC4)[C@H]3[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C26H33F3N2O3/c1-16-5-3-6-17-14-21-22(23(32)25(16,17)2)20(24(33)34-21)15-30-9-11-31(12-10-30)19-8-4-7-18(13-19)26(27,28)29/h4,6-8,13,16,20-23,32H,3,5,9-12,14-15H2,1-2H3/p+1/t16-,20-,21+,22+,23+,25+/m0/s1 |
| InChIKey | ACXRFOZINXTJCC-NMZOIUEUSA-O |
| XLogP | 2.70 |
| TPSA | 54.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|