C13H8BrCl2NO4 — CID 14039271
N-[2-(6-bromo-2-oxochromen-3-yl)-2-oxoethyl]-2,2-dichloroacetamide (PubChem CID 14039271) has the molecular formula C13H8BrCl2NO4 and a molecular weight of 393.02 g/mol. Its IUPAC name is N-[2-(6-bromo-2-oxochromen-3-yl)-2-oxoethyl]-2,2-dichloroacetamide.
| Compound Name | N-[2-(6-bromo-2-oxochromen-3-yl)-2-oxoethyl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 14039271 |
| Molecular Formula | C13H8BrCl2NO4 |
| Molecular Weight | 393.02 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | N-[2-(6-bromo-2-oxochromen-3-yl)-2-oxoethyl]-2,2-dichloroacetamide |
| SMILES | O=C(CNC(=O)C(Cl)Cl)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C13H8BrCl2NO4/c14-7-1-2-10-6(3-7)4-8(13(20)21-10)9(18)5-17-12(19)11(15)16/h1-4,11H,5H2,(H,17,19) |
| InChIKey | NBQGLOZHHFVTFT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.02 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|