About 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol
2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol (PubChem CID 14040391) has the molecular formula C17H28N4O2
and a molecular weight of 320.44 g/mol. Its IUPAC name is 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol.
Molecular Properties
| Compound Name | 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol |
| PubChem CID | 14040391 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol |
| SMILES | Cn1ccnc1C(C)(O)CCCCCC(C)(O)c1nccn1C |
| InChI | InChI=1S/C17H28N4O2/c1-16(22,14-18-10-12-20(14)3)8-6-5-7-9-17(2,23)15-19-11-13-21(15)4/h10-13,22-23H,5-9H2,1-4H3 |
| InChIKey | AFYHBXYOKMXDHR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol?
The IUPAC name of 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol (CID 14040391) is 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol.
What is the SMILES notation for 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol?
The canonical SMILES for 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol is Cn1ccnc1C(C)(O)CCCCCC(C)(O)c1nccn1C.
What is the InChIKey of 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol?
The InChIKey is AFYHBXYOKMXDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O2/c1-16(22,14-18-10-12-20(14)3)8-6-5-7-9-17(2,23)15-19-11-13-21(15)4/h10-13,22-23H,5-9H2,1-4H3.
What are the key properties of 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol?
2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol has a molecular weight of 320.44 g/mol, XLogP of 2.22, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-bis(1-methylimidazol-2-yl)nonane-2,8-diol is sourced from PubChem (CID 14040391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).