C26H37NO5 — CID 14041944
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1R,5R,7S)-2-acetyl-3,3,7-trimethyl-4,6-dioxa-2-azabicyclo[3.2.0]heptane-7-carboxylate (PubChem CID 14041944) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1R,5R,7S)-2-acetyl-3,3,7-trimethyl-4,6-dioxa-2-azabicyclo[3.2.0]heptane-7-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1R,5R,7S)-2-acetyl-3,3,7-trimethyl-4,6-dioxa-2-azabicyclo[3.2.0]heptane-7-carboxylate |
|---|---|
| PubChem CID | 14041944 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1R,5R,7S)-2-acetyl-3,3,7-trimethyl-4,6-dioxa-2-azabicyclo[3.2.0]heptane-7-carboxylate |
| SMILES | CC(=O)N1[C@H]2[C@@H](OC1(C)C)O[C@]2(C)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H37NO5/c1-16-13-14-19(24(3,4)18-11-9-8-10-12-18)20(15-16)30-23(29)26(7)21-22(32-26)31-25(5,6)27(21)17(2)28/h8-12,16,19-22H,13-15H2,1-7H3/t16-,19-,20-,21+,22+,26+/m1/s1 |
| InChIKey | JUDQGASZXRUQSN-QUJHXCBZSA-N |
| XLogP | 4.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |