C25H35NO6 — CID 14041954
2-O-methyl 7-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,5R,7S)-3,3-dimethyl-7-phenyl-4,6-dioxa-2-azabicyclo[3.2.0]heptane-2,7-dicarboxylate (PubChem CID 14041954) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is 2-O-methyl 7-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,5R,7S)-3,3-dimethyl-7-phenyl-4,6-dioxa-2-azabicyclo[3.2.0]heptane-2,7-dicarboxylate.
| Compound Name | 2-O-methyl 7-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,5R,7S)-3,3-dimethyl-7-phenyl-4,6-dioxa-2-azabicyclo[3.2.0]heptane-2,7-dicarboxylate |
|---|---|
| PubChem CID | 14041954 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 2-O-methyl 7-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,5R,7S)-3,3-dimethyl-7-phenyl-4,6-dioxa-2-azabicyclo[3.2.0]heptane-2,7-dicarboxylate |
| SMILES | COC(=O)N1[C@H]2[C@@H](OC1(C)C)O[C@@]2(C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H35NO6/c1-15(2)18-13-12-16(3)14-19(18)30-22(27)25(17-10-8-7-9-11-17)20-21(32-25)31-24(4,5)26(20)23(28)29-6/h7-11,15-16,18-21H,12-14H2,1-6H3/t16-,18+,19-,20+,21+,25+/m1/s1 |
| InChIKey | AMLZDFVUSYPIGP-GLYJAGPZSA-N |
| XLogP | 4.45 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |