C25H35NO5 — CID 14041921
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1S,5R,7R)-4-acetyl-3,3-dimethyl-7-phenyl-2,6-dioxa-4-azabicyclo[3.2.0]heptane-7-carboxylate (PubChem CID 14041921) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1S,5R,7R)-4-acetyl-3,3-dimethyl-7-phenyl-2,6-dioxa-4-azabicyclo[3.2.0]heptane-7-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1S,5R,7R)-4-acetyl-3,3-dimethyl-7-phenyl-2,6-dioxa-4-azabicyclo[3.2.0]heptane-7-carboxylate |
|---|---|
| PubChem CID | 14041921 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1S,5R,7R)-4-acetyl-3,3-dimethyl-7-phenyl-2,6-dioxa-4-azabicyclo[3.2.0]heptane-7-carboxylate |
| SMILES | CC(=O)N1[C@@H]2O[C@](C(=O)O[C@@H]3C[C@H](C)CC[C@H]3C(C)C)(c3ccccc3)[C@@H]2OC1(C)C |
| InChI | InChI=1S/C25H35NO5/c1-15(2)19-13-12-16(3)14-20(19)29-23(28)25(18-10-8-7-9-11-18)21-22(31-25)26(17(4)27)24(5,6)30-21/h7-11,15-16,19-22H,12-14H2,1-6H3/t16-,19+,20-,21-,22-,25-/m1/s1 |
| InChIKey | ZFQZULUORGJKLS-UXWHTCSHSA-N |
| XLogP | 4.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |