C26H33NO8 — CID 11027338
(1R,6R,7R,13R,15S,19R)-19-methoxy-18,18-dimethyl-7-(phenylmethoxymethyl)-5,9,12-trioxa-3-azatetracyclo[13.2.1.13,6.01,13]nonadecane-2,4,8-trione (PubChem CID 11027338) has the molecular formula C26H33NO8 and a molecular weight of 487.55 g/mol. Its IUPAC name is (1R,6R,7R,13R,15S,19R)-19-methoxy-18,18-dimethyl-7-(phenylmethoxymethyl)-5,9,12-trioxa-3-azatetracyclo[13.2.1.13,6.01,13]nonadecane-2,4,8-trione.
| Compound Name | (1R,6R,7R,13R,15S,19R)-19-methoxy-18,18-dimethyl-7-(phenylmethoxymethyl)-5,9,12-trioxa-3-azatetracyclo[13.2.1.13,6.01,13]nonadecane-2,4,8-trione |
|---|---|
| PubChem CID | 11027338 |
| Molecular Formula | C26H33NO8 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | (1R,6R,7R,13R,15S,19R)-19-methoxy-18,18-dimethyl-7-(phenylmethoxymethyl)-5,9,12-trioxa-3-azatetracyclo[13.2.1.13,6.01,13]nonadecane-2,4,8-trione |
| SMILES | CO[C@@H]1[C@@H]2OC(=O)N1C(=O)[C@@]13CC[C@@H](C[C@H]1OCCOC(=O)[C@@H]2COCc1ccccc1)C3(C)C |
| InChI | InChI=1S/C26H33NO8/c1-25(2)17-9-10-26(25)19(13-17)33-11-12-34-22(28)18(15-32-14-16-7-5-4-6-8-16)20-21(31-3)27(23(26)29)24(30)35-20/h4-8,17-21H,9-15H2,1-3H3/t17-,18+,19+,20+,21+,26+/m0/s1 |
| InChIKey | WKGKRYQXTNZLQU-PYPDTLBHSA-N |
| XLogP | 2.91 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |