C32H45NO5 — CID 11103357
tert-butyl (2S,3R,4S)-2-nonyl-5-oxo-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate (PubChem CID 11103357) has the molecular formula C32H45NO5 and a molecular weight of 523.71 g/mol. Its IUPAC name is tert-butyl (2S,3R,4S)-2-nonyl-5-oxo-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R,4S)-2-nonyl-5-oxo-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11103357 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | tert-butyl (2S,3R,4S)-2-nonyl-5-oxo-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCC[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H45NO5/c1-5-6-7-8-9-10-17-22-27-28(36-23-25-18-13-11-14-19-25)29(37-24-26-20-15-12-16-21-26)30(34)33(27)31(35)38-32(2,3)4/h11-16,18-21,27-29H,5-10,17,22-24H2,1-4H3/t27-,28+,29-/m0/s1 |
| InChIKey | RHUIHHSTZJZWGF-NHKHRBQYSA-N |
| XLogP | 7.44 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|