C31H39NO5 — CID 14041929
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,5R,7R)-4-acetyl-3,3-dimethyl-7-phenyl-2,6-dioxa-4-azabicyclo[3.2.0]heptane-7-carboxylate (PubChem CID 14041929) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,5R,7R)-4-acetyl-3,3-dimethyl-7-phenyl-2,6-dioxa-4-azabicyclo[3.2.0]heptane-7-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,5R,7R)-4-acetyl-3,3-dimethyl-7-phenyl-2,6-dioxa-4-azabicyclo[3.2.0]heptane-7-carboxylate |
|---|---|
| PubChem CID | 14041929 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,5R,7R)-4-acetyl-3,3-dimethyl-7-phenyl-2,6-dioxa-4-azabicyclo[3.2.0]heptane-7-carboxylate |
| SMILES | CC(=O)N1[C@@H]2O[C@](C(=O)O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)c3ccccc3)(c3ccccc3)[C@@H]2OC1(C)C |
| InChI | InChI=1S/C31H39NO5/c1-20-17-18-24(29(3,4)22-13-9-7-10-14-22)25(19-20)35-28(34)31(23-15-11-8-12-16-23)26-27(37-31)32(21(2)33)30(5,6)36-26/h7-16,20,24-27H,17-19H2,1-6H3/t20-,24-,25-,26-,27-,31-/m1/s1 |
| InChIKey | CHCLFPFTNLFWKL-BOWHILTNSA-N |
| XLogP | 5.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |