C29H43NO7 — CID 10052294
3-O-tert-butyl 5-O-(4-oxo-4-phenylmethoxybutyl) (4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate (PubChem CID 10052294) has the molecular formula C29H43NO7 and a molecular weight of 517.66 g/mol. Its IUPAC name is 3-O-tert-butyl 5-O-(4-oxo-4-phenylmethoxybutyl) (4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate.
| Compound Name | 3-O-tert-butyl 5-O-(4-oxo-4-phenylmethoxybutyl) (4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10052294 |
| Molecular Formula | C29H43NO7 |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | 3-O-tert-butyl 5-O-(4-oxo-4-phenylmethoxybutyl) (4S,5R)-4-(cyclohexylmethyl)-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC2CCCCC2)[C@H](C(=O)OCCCC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C29H43NO7/c1-28(2,3)37-27(33)30-23(19-21-13-8-6-9-14-21)25(36-29(30,4)5)26(32)34-18-12-17-24(31)35-20-22-15-10-7-11-16-22/h7,10-11,15-16,21,23,25H,6,8-9,12-14,17-20H2,1-5H3/t23-,25+/m0/s1 |
| InChIKey | QATVNORCZFJWAJ-UKILVPOCSA-N |
| XLogP | 5.76 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|