C21H14Na2O6S2 — CID 14047702
disodium;6-[(5-sulfonatonaphthalen-2-yl)methyl]naphthalene-1-sulfonate (PubChem CID 14047702) has the molecular formula C21H14Na2O6S2 and a molecular weight of 472.45 g/mol. Its IUPAC name is disodium;6-[(5-sulfonatonaphthalen-2-yl)methyl]naphthalene-1-sulfonate.
| Compound Name | disodium;6-[(5-sulfonatonaphthalen-2-yl)methyl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 14047702 |
| Molecular Formula | C21H14Na2O6S2 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | disodium;6-[(5-sulfonatonaphthalen-2-yl)methyl]naphthalene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1cccc2cc(Cc3ccc4c(S(=O)(=O)[O-])cccc4c3)ccc12.[Na+].[Na+] |
| InChI | InChI=1S/C21H16O6S2.2Na/c22-28(23,24)20-5-1-3-16-12-14(7-9-18(16)20)11-15-8-10-19-17(13-15)4-2-6-21(19)29(25,26)27;;/h1-10,12-13H,11H2,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2 |
| InChIKey | VBKMFMSNBISQCV-UHFFFAOYSA-L |
| XLogP | -2.60 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|