C27H30N4O2S — CID 140500098
2-[2-[1-(dimethylamino)ethoxy]phenyl]-3-phenyl-N-(1,3-thiazolidin-3-ylmethyl)furo[2,3-b]pyridin-4-amine (PubChem CID 140500098) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is 2-[2-[1-(dimethylamino)ethoxy]phenyl]-3-phenyl-N-(1,3-thiazolidin-3-ylmethyl)furo[2,3-b]pyridin-4-amine.
| Compound Name | 2-[2-[1-(dimethylamino)ethoxy]phenyl]-3-phenyl-N-(1,3-thiazolidin-3-ylmethyl)furo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 140500098 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-[2-[1-(dimethylamino)ethoxy]phenyl]-3-phenyl-N-(1,3-thiazolidin-3-ylmethyl)furo[2,3-b]pyridin-4-amine |
| SMILES | CC(Oc1ccccc1-c1oc2nccc(NCN3CCSC3)c2c1-c1ccccc1)N(C)C |
| InChI | InChI=1S/C27H30N4O2S/c1-19(30(2)3)32-23-12-8-7-11-21(23)26-24(20-9-5-4-6-10-20)25-22(13-14-28-27(25)33-26)29-17-31-15-16-34-18-31/h4-14,19H,15-18H2,1-3H3,(H,28,29) |
| InChIKey | PIRUSSBZTSVMDF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|