C22H20ClF3N2O4 — CID 140501041
(2,2,2-trifluoroacetyl) 3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indole-6-carboxylate (PubChem CID 140501041) has the molecular formula C22H20ClF3N2O4 and a molecular weight of 468.86 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indole-6-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 140501041 |
| Molecular Formula | C22H20ClF3N2O4 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indole-6-carboxylate |
| SMILES | C[C@H](Cc1c[nH]c2cc(C(=O)OC(=O)C(F)(F)F)ccc12)NC[C@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20ClF3N2O4/c1-12(27-11-19(29)13-3-2-4-16(23)8-13)7-15-10-28-18-9-14(5-6-17(15)18)20(30)32-21(31)22(24,25)26/h2-6,8-10,12,19,27-29H,7,11H2,1H3/t12-,19+/m1/s1 |
| InChIKey | LJZLDPLIAFQVOI-BLVKFPJESA-N |
| XLogP | 4.32 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|