C31H32N2O3 — CID 140502176
4-methoxy-N-[[4-[3-(naphthalen-2-ylmethoxy)piperidin-1-yl]phenyl]methyl]benzamide (PubChem CID 140502176) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is 4-methoxy-N-[[4-[3-(naphthalen-2-ylmethoxy)piperidin-1-yl]phenyl]methyl]benzamide.
| Compound Name | 4-methoxy-N-[[4-[3-(naphthalen-2-ylmethoxy)piperidin-1-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 140502176 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 4-methoxy-N-[[4-[3-(naphthalen-2-ylmethoxy)piperidin-1-yl]phenyl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc(N3CCCC(OCc4ccc5ccccc5c4)C3)cc2)cc1 |
| InChI | InChI=1S/C31H32N2O3/c1-35-29-16-12-26(13-17-29)31(34)32-20-23-9-14-28(15-10-23)33-18-4-7-30(21-33)36-22-24-8-11-25-5-2-3-6-27(25)19-24/h2-3,5-6,8-17,19,30H,4,7,18,20-22H2,1H3,(H,32,34) |
| InChIKey | GUFFDDDJBPGSHO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|