C20H23ClFN5O5 — CID 140504615
tert-butyl N-[8-chloro-1-cyclopropyl-6-fluoro-7-[(3Z)-3-hydroxyiminopyrrolidin-1-yl]-2,4-dioxoquinazolin-3-yl]carbamate (PubChem CID 140504615) has the molecular formula C20H23ClFN5O5 and a molecular weight of 467.89 g/mol. Its IUPAC name is tert-butyl N-[8-chloro-1-cyclopropyl-6-fluoro-7-[(3Z)-3-hydroxyiminopyrrolidin-1-yl]-2,4-dioxoquinazolin-3-yl]carbamate.
| Compound Name | tert-butyl N-[8-chloro-1-cyclopropyl-6-fluoro-7-[(3Z)-3-hydroxyiminopyrrolidin-1-yl]-2,4-dioxoquinazolin-3-yl]carbamate |
|---|---|
| PubChem CID | 140504615 |
| Molecular Formula | C20H23ClFN5O5 |
| Molecular Weight | 467.89 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | tert-butyl N-[8-chloro-1-cyclopropyl-6-fluoro-7-[(3Z)-3-hydroxyiminopyrrolidin-1-yl]-2,4-dioxoquinazolin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nn1c(=O)c2cc(F)c(N3CC/C(=N/O)C3)c(Cl)c2n(C2CC2)c1=O |
| InChI | InChI=1S/C20H23ClFN5O5/c1-20(2,3)32-18(29)23-27-17(28)12-8-13(22)16(25-7-6-10(9-25)24-31)14(21)15(12)26(19(27)30)11-4-5-11/h8,11,31H,4-7,9H2,1-3H3,(H,23,29)/b24-10- |
| InChIKey | FXIZDZNYLYNYPL-VROXFSQNSA-N |
| XLogP | 2.81 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|