C24H32FN5O5 — CID 58944933
tert-butyl N-[2-(3-amino-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dioxoquinazolin-7-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate (PubChem CID 58944933) has the molecular formula C24H32FN5O5 and a molecular weight of 489.55 g/mol. Its IUPAC name is tert-butyl N-[2-(3-amino-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dioxoquinazolin-7-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-(3-amino-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dioxoquinazolin-7-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
|---|---|
| PubChem CID | 58944933 |
| Molecular Formula | C24H32FN5O5 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | tert-butyl N-[2-(3-amino-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dioxoquinazolin-7-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
| SMILES | COc1c(N2CC3CCC(NC(=O)OC(C)(C)C)C3C2)c(F)cc2c(=O)n(N)c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C24H32FN5O5/c1-24(2,3)35-22(32)27-17-8-5-12-10-28(11-15(12)17)19-16(25)9-14-18(20(19)34-4)29(13-6-7-13)23(33)30(26)21(14)31/h9,12-13,15,17H,5-8,10-11,26H2,1-4H3,(H,27,32) |
| InChIKey | YZTLLYPXRDZTCW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |