C23H34FN5O4 — CID 143050412
tert-butyl N-[2-[3-(cyclopropylamino)-6-fluoro-4-(hydrazinecarbonyl)-2-methoxyphenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate (PubChem CID 143050412) has the molecular formula C23H34FN5O4 and a molecular weight of 463.55 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(cyclopropylamino)-6-fluoro-4-(hydrazinecarbonyl)-2-methoxyphenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(cyclopropylamino)-6-fluoro-4-(hydrazinecarbonyl)-2-methoxyphenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
|---|---|
| PubChem CID | 143050412 |
| Molecular Formula | C23H34FN5O4 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | tert-butyl N-[2-[3-(cyclopropylamino)-6-fluoro-4-(hydrazinecarbonyl)-2-methoxyphenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
| SMILES | COc1c(NC2CC2)c(C(=O)NN)cc(F)c1N1CC2CCC(NC(=O)OC(C)(C)C)C2C1 |
| InChI | InChI=1S/C23H34FN5O4/c1-23(2,3)33-22(31)27-17-8-5-12-10-29(11-15(12)17)19-16(24)9-14(21(30)28-25)18(20(19)32-4)26-13-6-7-13/h9,12-13,15,17,26H,5-8,10-11,25H2,1-4H3,(H,27,31)(H,28,30) |
| InChIKey | XBLRLBQCIOHHNG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|