C21H31FN4O4 — CID 166561177
tert-butyl N-[(3S,4R)-1-[3-amino-4-(cyclopropylamino)-5-fluorobenzoyl]-4-methoxypiperidin-3-yl]carbamate (PubChem CID 166561177) has the molecular formula C21H31FN4O4 and a molecular weight of 422.50 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-1-[3-amino-4-(cyclopropylamino)-5-fluorobenzoyl]-4-methoxypiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-1-[3-amino-4-(cyclopropylamino)-5-fluorobenzoyl]-4-methoxypiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 166561177 |
| Molecular Formula | C21H31FN4O4 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | tert-butyl N-[(3S,4R)-1-[3-amino-4-(cyclopropylamino)-5-fluorobenzoyl]-4-methoxypiperidin-3-yl]carbamate |
| SMILES | CO[C@@H]1CCN(C(=O)c2cc(N)c(NC3CC3)c(F)c2)C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31FN4O4/c1-21(2,3)30-20(28)25-16-11-26(8-7-17(16)29-4)19(27)12-9-14(22)18(15(23)10-12)24-13-5-6-13/h9-10,13,16-17,24H,5-8,11,23H2,1-4H3,(H,25,28)/t16-,17+/m0/s1 |
| InChIKey | RWILZFAIORDNDB-DLBZAZTESA-N |
| XLogP | 2.74 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|