C18H26FN3O4 — CID 151847702
ethyl 3-amino-5-fluoro-4-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate (PubChem CID 151847702) has the molecular formula C18H26FN3O4 and a molecular weight of 367.42 g/mol. Its IUPAC name is ethyl 3-amino-5-fluoro-4-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 3-amino-5-fluoro-4-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 151847702 |
| Molecular Formula | C18H26FN3O4 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | ethyl 3-amino-5-fluoro-4-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cc(N)c(N2CC[C@@H](NC(=O)OC(C)(C)C)C2)c(F)c1 |
| InChI | InChI=1S/C18H26FN3O4/c1-5-25-16(23)11-8-13(19)15(14(20)9-11)22-7-6-12(10-22)21-17(24)26-18(2,3)4/h8-9,12H,5-7,10,20H2,1-4H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | SHZXEWULCFDBHY-GFCCVEGCSA-N |
| XLogP | 2.69 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|