C18H23ClF2N2O4 — CID 86607131
ethyl 5-chloro-2,3-difluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate (PubChem CID 86607131) has the molecular formula C18H23ClF2N2O4 and a molecular weight of 404.84 g/mol. Its IUPAC name is ethyl 5-chloro-2,3-difluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 5-chloro-2,3-difluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 86607131 |
| Molecular Formula | C18H23ClF2N2O4 |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | ethyl 5-chloro-2,3-difluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(N2CCC(NC(=O)OC(C)(C)C)C2)c(F)c1F |
| InChI | InChI=1S/C18H23ClF2N2O4/c1-5-26-16(24)11-8-12(19)15(14(21)13(11)20)23-7-6-10(9-23)22-17(25)27-18(2,3)4/h8,10H,5-7,9H2,1-4H3,(H,22,25) |
| InChIKey | ILCZUEOFLWBQFZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|