C23H25F3N2O4 — CID 87680496
benzyl 2,3,5-trifluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate (PubChem CID 87680496) has the molecular formula C23H25F3N2O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is benzyl 2,3,5-trifluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate.
| Compound Name | benzyl 2,3,5-trifluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 87680496 |
| Molecular Formula | C23H25F3N2O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | benzyl 2,3,5-trifluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]benzoate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2c(F)cc(C(=O)OCc3ccccc3)c(F)c2F)C1 |
| InChI | InChI=1S/C23H25F3N2O4/c1-23(2,3)32-22(30)27-15-9-10-28(12-15)20-17(24)11-16(18(25)19(20)26)21(29)31-13-14-7-5-4-6-8-14/h4-8,11,15H,9-10,12-13H2,1-3H3,(H,27,30) |
| InChIKey | FJQGYMGBKNVVKA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|