C27H34Br2N2O3 — CID 140508836
tert-butyl 4-[(1R,2R)-2-[(3,5-dibromophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,4-diazepane-1-carboxylate (PubChem CID 140508836) has the molecular formula C27H34Br2N2O3 and a molecular weight of 594.39 g/mol. Its IUPAC name is tert-butyl 4-[(1R,2R)-2-[(3,5-dibromophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[(1R,2R)-2-[(3,5-dibromophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 140508836 |
| Molecular Formula | C27H34Br2N2O3 |
| Molecular Weight | 594.39 g/mol |
| Exact Mass | 592.09 |
| IUPAC Name | tert-butyl 4-[(1R,2R)-2-[(3,5-dibromophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN([C@@H]2c3ccccc3CC[C@H]2OCc2cc(Br)cc(Br)c2)CC1 |
| InChI | InChI=1S/C27H34Br2N2O3/c1-27(2,3)34-26(32)31-12-6-11-30(13-14-31)25-23-8-5-4-7-20(23)9-10-24(25)33-18-19-15-21(28)17-22(29)16-19/h4-5,7-8,15-17,24-25H,6,9-14,18H2,1-3H3/t24-,25-/m1/s1 |
| InChIKey | ZEGCKJJOKNGOBK-JWQCQUIFSA-N |
| XLogP | 6.73 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.39 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |