C29H32F6N2O3 — CID 140508838
tert-butyl 4-[(1R,2R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]piperazine-1-carboxylate (PubChem CID 140508838) has the molecular formula C29H32F6N2O3 and a molecular weight of 570.57 g/mol. Its IUPAC name is tert-butyl 4-[(1R,2R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1R,2R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140508838 |
| Molecular Formula | C29H32F6N2O3 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | tert-butyl 4-[(1R,2R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]piperazine-1-carboxylate |
| SMILES | C=C(O[C@@H]1CCc2ccccc2[C@H]1N1CCN(C(=O)OC(C)(C)C)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H32F6N2O3/c1-18(20-15-21(28(30,31)32)17-22(16-20)29(33,34)35)39-24-10-9-19-7-5-6-8-23(19)25(24)36-11-13-37(14-12-36)26(38)40-27(2,3)4/h5-8,15-17,24-25H,1,9-14H2,2-4H3/t24-,25-/m1/s1 |
| InChIKey | QUWJZZVNMZFGDC-JWQCQUIFSA-N |
| XLogP | 7.32 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|