C29H30F7NO3 — CID 87848808
tert-butyl (3aS,4S,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 87848808) has the molecular formula C29H30F7NO3 and a molecular weight of 573.55 g/mol. Its IUPAC name is tert-butyl (3aS,4S,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (3aS,4S,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 87848808 |
| Molecular Formula | C29H30F7NO3 |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | tert-butyl (3aS,4S,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | C=C(OC1CC[C@@H]2CN(C(=O)OC(C)(C)C)C[C@@H]2[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H30F7NO3/c1-16(19-11-20(28(31,32)33)13-21(12-19)29(34,35)36)39-24-10-7-18-14-37(26(38)40-27(2,3)4)15-23(18)25(24)17-5-8-22(30)9-6-17/h5-6,8-9,11-13,18,23-25H,1,7,10,14-15H2,2-4H3/t18-,23+,24?,25-/m1/s1 |
| InChIKey | NHQYLXAPWVTGHB-YBIROZEBSA-N |
| XLogP | 8.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|