C29H32F7NO4 — CID 25029614
tert-butyl (3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 25029614) has the molecular formula C29H32F7NO4 and a molecular weight of 591.56 g/mol. Its IUPAC name is tert-butyl (3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 25029614 |
| Molecular Formula | C29H32F7NO4 |
| Molecular Weight | 591.56 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | tert-butyl (3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@H](O[C@H](CO)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H](c3ccc(F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C29H32F7NO4/c1-27(2,3)41-26(39)37-13-17-6-9-23(25(22(17)14-37)16-4-7-21(30)8-5-16)40-24(15-38)18-10-19(28(31,32)33)12-20(11-18)29(34,35)36/h4-5,7-8,10-12,17,22-25,38H,6,9,13-15H2,1-3H3/t17-,22-,23+,24-,25+/m1/s1 |
| InChIKey | FNVUTVHAJQCWBV-GBLYOKOSSA-N |
| XLogP | 7.34 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |