C25H24F7NO3 — CID 90895006
1-[3,5-bis(trifluoromethyl)phenyl]ethyl 4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboperoxoate (PubChem CID 90895006) has the molecular formula C25H24F7NO3 and a molecular weight of 519.46 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]ethyl 4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboperoxoate.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethyl 4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboperoxoate |
|---|---|
| PubChem CID | 90895006 |
| Molecular Formula | C25H24F7NO3 |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethyl 4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboperoxoate |
| SMILES | CC(OOC(=O)N1CC2CCCC(c3ccc(F)cc3)C2C1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F7NO3/c1-14(17-9-18(24(27,28)29)11-19(10-17)25(30,31)32)35-36-23(34)33-12-16-3-2-4-21(22(16)13-33)15-5-7-20(26)8-6-15/h5-11,14,16,21-22H,2-4,12-13H2,1H3 |
| InChIKey | WIDWNVSKLZLXTD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|