C25H23F7NO3- — CID 154457138
1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 154457138) has the molecular formula C25H23F7NO3- and a molecular weight of 518.45 g/mol. Its IUPAC name is 1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | 1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 154457138 |
| Molecular Formula | C25H23F7NO3- |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | C[C@@H](OC1C2CCCC(c3ccc(F)cc3)C2CN1C(=O)[O-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F7NO3/c1-13(15-9-16(24(27,28)29)11-17(10-15)25(30,31)32)36-22-20-4-2-3-19(14-5-7-18(26)8-6-14)21(20)12-33(22)23(34)35/h5-11,13,19-22H,2-4,12H2,1H3,(H,34,35)/p-1/t13-,19?,20?,21?,22?/m1/s1 |
| InChIKey | CAJPZUNEDXMBKB-FGWQCQKKSA-M |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |