C23H20F7IO2 — CID 89146080
1-[(3S)-3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-2-iodoethanone (PubChem CID 89146080) has the molecular formula C23H20F7IO2 and a molecular weight of 588.30 g/mol. Its IUPAC name is 1-[(3S)-3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-2-iodoethanone.
| Compound Name | 1-[(3S)-3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-2-iodoethanone |
|---|---|
| PubChem CID | 89146080 |
| Molecular Formula | C23H20F7IO2 |
| Molecular Weight | 588.30 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | 1-[(3S)-3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-2-iodoethanone |
| SMILES | CC(O[C@H]1CCC(C(=O)CI)C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F7IO2/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)33-20-7-6-18(19(32)11-31)21(20)13-2-4-17(24)5-3-13/h2-5,8-10,12,18,20-21H,6-7,11H2,1H3/t12?,18?,20-,21?/m0/s1 |
| InChIKey | UOXUGVOCEKLKAR-UIXCGDMDSA-N |
| XLogP | 7.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.30 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|