C26H27F7O4 — CID 86628112
ethyl (1R,2R,3S,6S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-6-(hydroxymethyl)cyclohexane-1-carboxylate (PubChem CID 86628112) has the molecular formula C26H27F7O4 and a molecular weight of 536.48 g/mol. Its IUPAC name is ethyl (1R,2R,3S,6S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-6-(hydroxymethyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2R,3S,6S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-6-(hydroxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86628112 |
| Molecular Formula | C26H27F7O4 |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | ethyl (1R,2R,3S,6S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-6-(hydroxymethyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](CO)CC[C@H](O[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H27F7O4/c1-3-36-24(35)23-16(13-34)6-9-21(22(23)15-4-7-20(27)8-5-15)37-14(2)17-10-18(25(28,29)30)12-19(11-17)26(31,32)33/h4-5,7-8,10-12,14,16,21-23,34H,3,6,9,13H2,1-2H3/t14-,16-,21+,22-,23-/m1/s1 |
| InChIKey | JJSBDOKPIOQGNY-UDEOYYGDSA-N |
| XLogP | 6.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |