C26H29F7O7S2 — CID 42639485
[(1S,2R,3R,4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)-2-(methylsulfonyloxymethyl)cyclohexyl]methyl methanesulfonate (PubChem CID 42639485) has the molecular formula C26H29F7O7S2 and a molecular weight of 650.63 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)-2-(methylsulfonyloxymethyl)cyclohexyl]methyl methanesulfonate.
| Compound Name | [(1S,2R,3R,4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)-2-(methylsulfonyloxymethyl)cyclohexyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 42639485 |
| Molecular Formula | C26H29F7O7S2 |
| Molecular Weight | 650.63 g/mol |
| Exact Mass | 650.12 |
| IUPAC Name | [(1S,2R,3R,4S)-4-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)-2-(methylsulfonyloxymethyl)cyclohexyl]methyl methanesulfonate |
| SMILES | C[C@@H](O[C@H]1CC[C@H](COS(C)(=O)=O)[C@@H](COS(C)(=O)=O)[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H29F7O7S2/c1-15(18-10-19(25(28,29)30)12-20(11-18)26(31,32)33)40-23-9-6-17(13-38-41(2,34)35)22(14-39-42(3,36)37)24(23)16-4-7-21(27)8-5-16/h4-5,7-8,10-12,15,17,22-24H,6,9,13-14H2,1-3H3/t15-,17-,22-,23+,24+/m1/s1 |
| InChIKey | KUUGZSCQHYAOAS-MJJUOVOUSA-N |
| XLogP | 6.07 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|