C26H28F7NO2 — CID 11713337
2-[(4R,5S)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethanol (PubChem CID 11713337) has the molecular formula C26H28F7NO2 and a molecular weight of 519.50 g/mol. Its IUPAC name is 2-[(4R,5S)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethanol.
| Compound Name | 2-[(4R,5S)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethanol |
|---|---|
| PubChem CID | 11713337 |
| Molecular Formula | C26H28F7NO2 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-[(4R,5S)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethanol |
| SMILES | C[C@@H](O[C@H]1CCC2CN(CCO)CC2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H28F7NO2/c1-15(18-10-19(25(28,29)30)12-20(11-18)26(31,32)33)36-23-7-4-17-13-34(8-9-35)14-22(17)24(23)16-2-5-21(27)6-3-16/h2-3,5-6,10-12,15,17,22-24,35H,4,7-9,13-14H2,1H3/t15-,17?,22?,23+,24+/m1/s1 |
| InChIKey | RMURTBSDXJKGJY-AOBMTXRDSA-N |
| XLogP | 6.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |